C9H12N2S — CID 143084168
5-[(1Z)-2-methylbuta-1,3-dienyl]-4-methylsulfanyl-1H-pyrazole (PubChem CID 143084168) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is 5-[(1Z)-2-methylbuta-1,3-dienyl]-4-methylsulfanyl-1H-pyrazole.
| Compound Name | 5-[(1Z)-2-methylbuta-1,3-dienyl]-4-methylsulfanyl-1H-pyrazole |
|---|---|
| PubChem CID | 143084168 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 5-[(1Z)-2-methylbuta-1,3-dienyl]-4-methylsulfanyl-1H-pyrazole |
| SMILES | C=C/C(C)=C\c1[nH]ncc1SC |
| InChI | InChI=1S/C9H12N2S/c1-4-7(2)5-8-9(12-3)6-10-11-8/h4-6H,1H2,2-3H3,(H,10,11)/b7-5- |
| InChIKey | ILFBNBPQDQJWAC-ALCCZGGFSA-N |
| XLogP | 2.72 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|