C23H28F3NO4 — CID 143085682
benzyl (1R)-4-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]-2-propylcyclopent-2-ene-1-carboxylate (PubChem CID 143085682) has the molecular formula C23H28F3NO4 and a molecular weight of 439.47 g/mol. Its IUPAC name is benzyl (1R)-4-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]-2-propylcyclopent-2-ene-1-carboxylate.
| Compound Name | benzyl (1R)-4-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]-2-propylcyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 143085682 |
| Molecular Formula | C23H28F3NO4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | benzyl (1R)-4-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]-2-propylcyclopent-2-ene-1-carboxylate |
| SMILES | CCCC1=CC(N(C(=O)C(F)(F)F)C2CCOCC2)C[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H28F3NO4/c1-2-6-17-13-19(14-20(17)21(28)31-15-16-7-4-3-5-8-16)27(22(29)23(24,25)26)18-9-11-30-12-10-18/h3-5,7-8,13,18-20H,2,6,9-12,14-15H2,1H3/t19?,20-/m1/s1 |
| InChIKey | QDEOVCXAGBVMOI-GFOWMXPYSA-N |
| XLogP | 4.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|