C17H33N7O — CID 143087703
4-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]-N'-hydroxycyclohexane-1-carboximidamide;ethane (PubChem CID 143087703) has the molecular formula C17H33N7O and a molecular weight of 351.50 g/mol. Its IUPAC name is 4-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]-N'-hydroxycyclohexane-1-carboximidamide;ethane.
| Compound Name | 4-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]-N'-hydroxycyclohexane-1-carboximidamide;ethane |
|---|---|
| PubChem CID | 143087703 |
| Molecular Formula | C17H33N7O |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | 4-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]-N'-hydroxycyclohexane-1-carboximidamide;ethane |
| SMILES | CC.CC.[H]/N=C(\C)c1c(N)ncnc1NC1CCC(/C(N)=N/O)CC1 |
| InChI | InChI=1S/C13H21N7O.2C2H6/c1-7(14)10-12(16)17-6-18-13(10)19-9-4-2-8(3-5-9)11(15)20-21;2*1-2/h6,8-9,14,21H,2-5H2,1H3,(H2,15,20)(H3,16,17,18,19);2*1-2H3/b14-7+;; |
| InChIKey | MCGPWMXMQTTWHC-MOEKMLTRSA-N |
| XLogP | 3.22 |
| TPSA | 146.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|