C40H50F5NO3S — CID 143088994
[(19R)-19-[5-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]pentyl]-4-oxo-15-hexacyclo[9.8.0.02,8.05,7.05,8.012,17]nonadeca-12(17),13,15-trienyl] cyclohexa-1,5-diene-1-carboxylate (PubChem CID 143088994) has the molecular formula C40H50F5NO3S and a molecular weight of 719.90 g/mol. Its IUPAC name is [(19R)-19-[5-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]pentyl]-4-oxo-15-hexacyclo[9.8.0.02,8.05,7.05,8.012,17]nonadeca-12(17),13,15-trienyl] cyclohexa-1,5-diene-1-carboxylate.
| Compound Name | [(19R)-19-[5-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]pentyl]-4-oxo-15-hexacyclo[9.8.0.02,8.05,7.05,8.012,17]nonadeca-12(17),13,15-trienyl] cyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 143088994 |
| Molecular Formula | C40H50F5NO3S |
| Molecular Weight | 719.90 g/mol |
| Exact Mass | 719.34 |
| IUPAC Name | [(19R)-19-[5-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]pentyl]-4-oxo-15-hexacyclo[9.8.0.02,8.05,7.05,8.012,17]nonadeca-12(17),13,15-trienyl] cyclohexa-1,5-diene-1-carboxylate |
| SMILES | CN(CCCCCC1Cc2cc(OC(=O)C3=CCCC=C3)ccc2C2CCC34C(CC(=O)C35CC54)C12)CCCSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C40H50F5NO3S/c1-46(19-9-21-50-20-8-16-39(41,42)40(43,44)45)18-7-3-6-12-27-22-28-23-29(49-36(48)26-10-4-2-5-11-26)13-14-30(28)31-15-17-37-32(35(27)31)24-34(47)38(37)25-33(37)38/h4,10-11,13-14,23,27,31-33,35H,2-3,5-9,12,15-22,24-25H2,1H3 |
| InChIKey | BHNGMCCYKRAHNL-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.90 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|