C29H37F5O3S — CID 168918151
[17-hydroxy-13-methyl-7-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)but-3-enyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 168918151) has the molecular formula C29H37F5O3S and a molecular weight of 560.67 g/mol. Its IUPAC name is [17-hydroxy-13-methyl-7-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)but-3-enyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [17-hydroxy-13-methyl-7-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)but-3-enyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 168918151 |
| Molecular Formula | C29H37F5O3S |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | [17-hydroxy-13-methyl-7-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)but-3-enyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | C=C(CCC1Cc2cc(OC(C)=O)ccc2C2CCC3(C)C(O)CCC3C12)SCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C29H37F5O3S/c1-17(38-14-4-12-28(30,31)29(32,33)34)5-6-19-15-20-16-21(37-18(2)35)7-8-22(20)23-11-13-27(3)24(26(19)23)9-10-25(27)36/h7-8,16,19,23-26,36H,1,4-6,9-15H2,2-3H3 |
| InChIKey | GFSWHOQOMHBDNX-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|