C31H32F2O6 — CID 143091172
tert-butyl (Z)-5-(2,6-difluorophenyl)-5-oxo-4-[[3-(2,3,4-trimethoxyphenyl)phenyl]methyl]pent-3-enoate (PubChem CID 143091172) has the molecular formula C31H32F2O6 and a molecular weight of 538.59 g/mol. Its IUPAC name is tert-butyl (Z)-5-(2,6-difluorophenyl)-5-oxo-4-[[3-(2,3,4-trimethoxyphenyl)phenyl]methyl]pent-3-enoate.
| Compound Name | tert-butyl (Z)-5-(2,6-difluorophenyl)-5-oxo-4-[[3-(2,3,4-trimethoxyphenyl)phenyl]methyl]pent-3-enoate |
|---|---|
| PubChem CID | 143091172 |
| Molecular Formula | C31H32F2O6 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | tert-butyl (Z)-5-(2,6-difluorophenyl)-5-oxo-4-[[3-(2,3,4-trimethoxyphenyl)phenyl]methyl]pent-3-enoate |
| SMILES | COc1ccc(-c2cccc(C/C(=C/CC(=O)OC(C)(C)C)C(=O)c3c(F)cccc3F)c2)c(OC)c1OC |
| InChI | InChI=1S/C31H32F2O6/c1-31(2,3)39-26(34)16-13-21(28(35)27-23(32)11-8-12-24(27)33)18-19-9-7-10-20(17-19)22-14-15-25(36-4)30(38-6)29(22)37-5/h7-15,17H,16,18H2,1-6H3/b21-13- |
| InChIKey | QDYDBWZUDRJGAI-BKUYFWCQSA-N |
| XLogP | 6.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|