C30H32O5 — CID 167622936
tert-butyl 2-[2-[[7-(3-ethylphenyl)-1-benzofuran-5-yl]methoxy]-5-methoxyphenyl]acetate (PubChem CID 167622936) has the molecular formula C30H32O5 and a molecular weight of 472.58 g/mol. Its IUPAC name is tert-butyl 2-[2-[[7-(3-ethylphenyl)-1-benzofuran-5-yl]methoxy]-5-methoxyphenyl]acetate.
| Compound Name | tert-butyl 2-[2-[[7-(3-ethylphenyl)-1-benzofuran-5-yl]methoxy]-5-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 167622936 |
| Molecular Formula | C30H32O5 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | tert-butyl 2-[2-[[7-(3-ethylphenyl)-1-benzofuran-5-yl]methoxy]-5-methoxyphenyl]acetate |
| SMILES | CCc1cccc(-c2cc(COc3ccc(OC)cc3CC(=O)OC(C)(C)C)cc3ccoc23)c1 |
| InChI | InChI=1S/C30H32O5/c1-6-20-8-7-9-22(14-20)26-16-21(15-23-12-13-33-29(23)26)19-34-27-11-10-25(32-5)17-24(27)18-28(31)35-30(2,3)4/h7-17H,6,18-19H2,1-5H3 |
| InChIKey | XEVWJMSEABQSTL-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |