C24H21NO4 — CID 139560996
methyl 2-[[7-[3-(aminomethyl)phenyl]-1-benzofuran-5-yl]methoxy]benzoate (PubChem CID 139560996) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is methyl 2-[[7-[3-(aminomethyl)phenyl]-1-benzofuran-5-yl]methoxy]benzoate.
| Compound Name | methyl 2-[[7-[3-(aminomethyl)phenyl]-1-benzofuran-5-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 139560996 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | methyl 2-[[7-[3-(aminomethyl)phenyl]-1-benzofuran-5-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccccc1OCc1cc(-c2cccc(CN)c2)c2occc2c1 |
| InChI | InChI=1S/C24H21NO4/c1-27-24(26)20-7-2-3-8-22(20)29-15-17-12-19-9-10-28-23(19)21(13-17)18-6-4-5-16(11-18)14-25/h2-13H,14-15,25H2,1H3 |
| InChIKey | SBBAAZDLUUEIAR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |