About [3-[5-(cyclohexa-1,5-dien-1-yloxymethyl)-1-benzofuran-7-yl]phenyl]methanamine
[3-[5-(cyclohexa-1,5-dien-1-yloxymethyl)-1-benzofuran-7-yl]phenyl]methanamine (PubChem CID 156724899) has the molecular formula C22H21NO2
and a molecular weight of 331.42 g/mol. Its IUPAC name is [3-[5-(cyclohexa-1,5-dien-1-yloxymethyl)-1-benzofuran-7-yl]phenyl]methanamine.
Molecular Properties
| Compound Name | [3-[5-(cyclohexa-1,5-dien-1-yloxymethyl)-1-benzofuran-7-yl]phenyl]methanamine |
| PubChem CID | 156724899 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | [3-[5-(cyclohexa-1,5-dien-1-yloxymethyl)-1-benzofuran-7-yl]phenyl]methanamine |
| SMILES | NCc1cccc(-c2cc(COC3=CCCC=C3)cc3ccoc23)c1 |
| InChI | InChI=1S/C22H21NO2/c23-14-16-5-4-6-18(11-16)21-13-17(12-19-9-10-24-22(19)21)15-25-20-7-2-1-3-8-20/h2,4-13H,1,3,14-15,23H2 |
| InChIKey | GEOPBGGNJKLSAD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-[5-(cyclohexa-1,5-dien-1-yloxymethyl)-1-benzofuran-7-yl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[5-(cyclohexa-1,5-dien-1-yloxymethyl)-1-benzofuran-7-yl]phenyl]methanamine?
The IUPAC name of [3-[5-(cyclohexa-1,5-dien-1-yloxymethyl)-1-benzofuran-7-yl]phenyl]methanamine (CID 156724899) is [3-[5-(cyclohexa-1,5-dien-1-yloxymethyl)-1-benzofuran-7-yl]phenyl]methanamine.
What is the SMILES notation for [3-[5-(cyclohexa-1,5-dien-1-yloxymethyl)-1-benzofuran-7-yl]phenyl]methanamine?
The canonical SMILES for [3-[5-(cyclohexa-1,5-dien-1-yloxymethyl)-1-benzofuran-7-yl]phenyl]methanamine is NCc1cccc(-c2cc(COC3=CCCC=C3)cc3ccoc23)c1.
What is the InChIKey of [3-[5-(cyclohexa-1,5-dien-1-yloxymethyl)-1-benzofuran-7-yl]phenyl]methanamine?
The InChIKey is GEOPBGGNJKLSAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO2/c23-14-16-5-4-6-18(11-16)21-13-17(12-19-9-10-24-22(19)21)15-25-20-7-2-1-3-8-20/h2,4-13H,1,3,14-15,23H2.
What are the key properties of [3-[5-(cyclohexa-1,5-dien-1-yloxymethyl)-1-benzofuran-7-yl]phenyl]methanamine?
[3-[5-(cyclohexa-1,5-dien-1-yloxymethyl)-1-benzofuran-7-yl]phenyl]methanamine has a molecular weight of 331.42 g/mol, XLogP of 5.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[5-(cyclohexa-1,5-dien-1-yloxymethyl)-1-benzofuran-7-yl]phenyl]methanamine is sourced from PubChem (CID 156724899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).