About [3-[5-[[2-(aminomethyl)-6-ethylphenoxy]methyl]-1-benzofuran-7-yl]phenyl]methanamine;formic acid
[3-[5-[[2-(aminomethyl)-6-ethylphenoxy]methyl]-1-benzofuran-7-yl]phenyl]methanamine;formic acid (PubChem CID 156725019) has the molecular formula C26H28N2O4
and a molecular weight of 432.52 g/mol. Its IUPAC name is [3-[5-[[2-(aminomethyl)-6-ethylphenoxy]methyl]-1-benzofuran-7-yl]phenyl]methanamine;formic acid.
Molecular Properties
| Compound Name | [3-[5-[[2-(aminomethyl)-6-ethylphenoxy]methyl]-1-benzofuran-7-yl]phenyl]methanamine;formic acid |
| PubChem CID | 156725019 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | [3-[5-[[2-(aminomethyl)-6-ethylphenoxy]methyl]-1-benzofuran-7-yl]phenyl]methanamine;formic acid |
| SMILES | CCc1cccc(CN)c1OCc1cc(-c2cccc(CN)c2)c2occc2c1.O=CO |
| InChI | InChI=1S/C25H26N2O2.CH2O2/c1-2-19-6-4-8-22(15-27)24(19)29-16-18-12-21-9-10-28-25(21)23(13-18)20-7-3-5-17(11-20)14-26;2-1-3/h3-13H,2,14-16,26-27H2,1H3;1H,(H,2,3) |
| InChIKey | YSGXIJYDMBHEBR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [3-[5-[[2-(aminomethyl)-6-ethylphenoxy]methyl]-1-benzofuran-7-yl]phenyl]methanamine;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[5-[[2-(aminomethyl)-6-ethylphenoxy]methyl]-1-benzofuran-7-yl]phenyl]methanamine;formic acid?
The IUPAC name of [3-[5-[[2-(aminomethyl)-6-ethylphenoxy]methyl]-1-benzofuran-7-yl]phenyl]methanamine;formic acid (CID 156725019) is [3-[5-[[2-(aminomethyl)-6-ethylphenoxy]methyl]-1-benzofuran-7-yl]phenyl]methanamine;formic acid.
What is the SMILES notation for [3-[5-[[2-(aminomethyl)-6-ethylphenoxy]methyl]-1-benzofuran-7-yl]phenyl]methanamine;formic acid?
The canonical SMILES for [3-[5-[[2-(aminomethyl)-6-ethylphenoxy]methyl]-1-benzofuran-7-yl]phenyl]methanamine;formic acid is CCc1cccc(CN)c1OCc1cc(-c2cccc(CN)c2)c2occc2c1.O=CO.
What is the InChIKey of [3-[5-[[2-(aminomethyl)-6-ethylphenoxy]methyl]-1-benzofuran-7-yl]phenyl]methanamine;formic acid?
The InChIKey is YSGXIJYDMBHEBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N2O2.CH2O2/c1-2-19-6-4-8-22(15-27)24(19)29-16-18-12-21-9-10-28-25(21)23(13-18)20-7-3-5-17(11-20)14-26;2-1-3/h3-13H,2,14-16,26-27H2,1H3;1H,(H,2,3).
What are the key properties of [3-[5-[[2-(aminomethyl)-6-ethylphenoxy]methyl]-1-benzofuran-7-yl]phenyl]methanamine;formic acid?
[3-[5-[[2-(aminomethyl)-6-ethylphenoxy]methyl]-1-benzofuran-7-yl]phenyl]methanamine;formic acid has a molecular weight of 432.52 g/mol, XLogP of 4.86, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[5-[[2-(aminomethyl)-6-ethylphenoxy]methyl]-1-benzofuran-7-yl]phenyl]methanamine;formic acid is sourced from PubChem (CID 156725019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).