C16H21NO4 — CID 143093788
methyl 2-(4-ethoxypent-4-enoylamino)-4-methylbenzoate (PubChem CID 143093788) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is methyl 2-(4-ethoxypent-4-enoylamino)-4-methylbenzoate.
| Compound Name | methyl 2-(4-ethoxypent-4-enoylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 143093788 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | methyl 2-(4-ethoxypent-4-enoylamino)-4-methylbenzoate |
| SMILES | C=C(CCC(=O)Nc1cc(C)ccc1C(=O)OC)OCC |
| InChI | InChI=1S/C16H21NO4/c1-5-21-12(3)7-9-15(18)17-14-10-11(2)6-8-13(14)16(19)20-4/h6,8,10H,3,5,7,9H2,1-2,4H3,(H,17,18) |
| InChIKey | ODANXVOIXLJIDY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|