C43H66N4O4 — CID 143093967
4-heptyl-3-[methyl-[2-(methylamino)ethyl]amino]benzaldehyde;2-methylbuta-1,3-diene;1-[4-morpholin-4-yl-3-[[(E)-pent-2-en-3-yl]oxymethyl]phenyl]pyrrolidin-2-one (PubChem CID 143093967) has the molecular formula C43H66N4O4 and a molecular weight of 703.02 g/mol. Its IUPAC name is 4-heptyl-3-[methyl-[2-(methylamino)ethyl]amino]benzaldehyde;2-methylbuta-1,3-diene;1-[4-morpholin-4-yl-3-[[(E)-pent-2-en-3-yl]oxymethyl]phenyl]pyrrolidin-2-one.
| Compound Name | 4-heptyl-3-[methyl-[2-(methylamino)ethyl]amino]benzaldehyde;2-methylbuta-1,3-diene;1-[4-morpholin-4-yl-3-[[(E)-pent-2-en-3-yl]oxymethyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 143093967 |
| Molecular Formula | C43H66N4O4 |
| Molecular Weight | 703.02 g/mol |
| Exact Mass | 702.51 |
| IUPAC Name | 4-heptyl-3-[methyl-[2-(methylamino)ethyl]amino]benzaldehyde;2-methylbuta-1,3-diene;1-[4-morpholin-4-yl-3-[[(E)-pent-2-en-3-yl]oxymethyl]phenyl]pyrrolidin-2-one |
| SMILES | C/C=C(\CC)OCc1cc(N2CCCC2=O)ccc1N1CCOCC1.C=CC(=C)C.CCCCCCCc1ccc(C=O)cc1N(C)CCNC |
| InChI | InChI=1S/C20H28N2O3.C18H30N2O.C5H8/c1-3-18(4-2)25-15-16-14-17(22-9-5-6-20(22)23)7-8-19(16)21-10-12-24-13-11-21;1-4-5-6-7-8-9-17-11-10-16(15-21)14-18(17)20(3)13-12-19-2;1-4-5(2)3/h3,7-8,14H,4-6,9-13,15H2,1-2H3;10-11,14-15,19H,4-9,12-13H2,1-3H3;4H,1-2H2,3H3/b18-3+;; |
| InChIKey | OHERYMDBDKBOFP-CRLFTPMMSA-N |
| XLogP | 8.90 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.02 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|