C25H35NO2 — CID 143093672
3-[(7Z,9Z)-10-but-1-en-2-yl-1-oxa-4-azacycloundeca-7,9-dien-4-yl]-4-pentylbenzaldehyde (PubChem CID 143093672) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is 3-[(7Z,9Z)-10-but-1-en-2-yl-1-oxa-4-azacycloundeca-7,9-dien-4-yl]-4-pentylbenzaldehyde.
| Compound Name | 3-[(7Z,9Z)-10-but-1-en-2-yl-1-oxa-4-azacycloundeca-7,9-dien-4-yl]-4-pentylbenzaldehyde |
|---|---|
| PubChem CID | 143093672 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | 3-[(7Z,9Z)-10-but-1-en-2-yl-1-oxa-4-azacycloundeca-7,9-dien-4-yl]-4-pentylbenzaldehyde |
| SMILES | C=C(CC)/C1=C/C=C\CCN(c2cc(C=O)ccc2CCCCC)CCOC1 |
| InChI | InChI=1S/C25H35NO2/c1-4-6-8-11-23-14-13-22(19-27)18-25(23)26-15-10-7-9-12-24(21(3)5-2)20-28-17-16-26/h7,9,12-14,18-19H,3-6,8,10-11,15-17,20H2,1-2H3/b9-7-,24-12+ |
| InChIKey | IOBSHRTVHWUXPU-OLFUXPTBSA-N |
| XLogP | 5.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|