About [6-(2-aminoethyl)cyclohepta-1,3,6-trien-1-yl]methanol
[6-(2-aminoethyl)cyclohepta-1,3,6-trien-1-yl]methanol (PubChem CID 143093980) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is [6-(2-aminoethyl)cyclohepta-1,3,6-trien-1-yl]methanol.
Analyze [6-(2-aminoethyl)cyclohepta-1,3,6-trien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2-aminoethyl)cyclohepta-1,3,6-trien-1-yl]methanol?
The IUPAC name of [6-(2-aminoethyl)cyclohepta-1,3,6-trien-1-yl]methanol (CID 143093980) is [6-(2-aminoethyl)cyclohepta-1,3,6-trien-1-yl]methanol.
What is the SMILES notation for [6-(2-aminoethyl)cyclohepta-1,3,6-trien-1-yl]methanol?
The canonical SMILES for [6-(2-aminoethyl)cyclohepta-1,3,6-trien-1-yl]methanol is NCCC1=CC(CO)=CC=CC1.
What is the InChIKey of [6-(2-aminoethyl)cyclohepta-1,3,6-trien-1-yl]methanol?
The InChIKey is IJRGOCARJCPSAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c11-6-5-9-3-1-2-4-10(7-9)8-12/h1-2,4,7,12H,3,5-6,8,11H2.
What are the key properties of [6-(2-aminoethyl)cyclohepta-1,3,6-trien-1-yl]methanol?
[6-(2-aminoethyl)cyclohepta-1,3,6-trien-1-yl]methanol has a molecular weight of 165.24 g/mol, XLogP of 1.14, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2-aminoethyl)cyclohepta-1,3,6-trien-1-yl]methanol is sourced from PubChem (CID 143093980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).