C9H14FNO — CID 176967958
(5Z)-1-amino-7-fluoro-4-methylideneocta-5,7-dien-3-ol (PubChem CID 176967958) has the molecular formula C9H14FNO and a molecular weight of 171.21 g/mol. Its IUPAC name is (5Z)-1-amino-7-fluoro-4-methylideneocta-5,7-dien-3-ol.
| Compound Name | (5Z)-1-amino-7-fluoro-4-methylideneocta-5,7-dien-3-ol |
|---|---|
| PubChem CID | 176967958 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.21 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | (5Z)-1-amino-7-fluoro-4-methylideneocta-5,7-dien-3-ol |
| SMILES | C=C(F)/C=C\C(=C)C(O)CCN |
| InChI | InChI=1S/C9H14FNO/c1-7(3-4-8(2)10)9(12)5-6-11/h3-4,9,12H,1-2,5-6,11H2/b4-3- |
| InChIKey | DONDEBSPNVJFIQ-ARJAWSKDSA-N |
| XLogP | 1.29 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|