C10H13FNOY- — CID 59753088
(1R,2S)-2-amino-3-fluoro-1-(3-methylbenzene-4-id-1-yl)propan-1-ol;yttrium (PubChem CID 59753088) has the molecular formula C10H13FNOY- and a molecular weight of 271.12 g/mol. Its IUPAC name is (1R,2S)-2-amino-3-fluoro-1-(3-methylbenzene-4-id-1-yl)propan-1-ol;yttrium.
| Compound Name | (1R,2S)-2-amino-3-fluoro-1-(3-methylbenzene-4-id-1-yl)propan-1-ol;yttrium |
|---|---|
| PubChem CID | 59753088 |
| Molecular Formula | C10H13FNOY- |
| Molecular Weight | 271.12 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | (1R,2S)-2-amino-3-fluoro-1-(3-methylbenzene-4-id-1-yl)propan-1-ol;yttrium |
| SMILES | Cc1[c-]ccc([C@@H](O)[C@H](N)CF)c1.[Y] |
| InChI | InChI=1S/C10H13FNO.Y/c1-7-3-2-4-8(5-7)10(13)9(12)6-11;/h2,4-5,9-10,13H,6,12H2,1H3;/q-1;/t9-,10-;/m1./s1 |
| InChIKey | BPYIEZYOFZBYLP-DHTOPLTISA-N |
| XLogP | 1.12 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.12 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|