C12H20FNO2 — CID 143418356
(3Z,5E)-5-(2-amino-3-fluoro-1-methoxypropyl)octa-3,5,7-trien-1-ol (PubChem CID 143418356) has the molecular formula C12H20FNO2 and a molecular weight of 229.29 g/mol. Its IUPAC name is (3Z,5E)-5-(2-amino-3-fluoro-1-methoxypropyl)octa-3,5,7-trien-1-ol.
| Compound Name | (3Z,5E)-5-(2-amino-3-fluoro-1-methoxypropyl)octa-3,5,7-trien-1-ol |
|---|---|
| PubChem CID | 143418356 |
| Molecular Formula | C12H20FNO2 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (3Z,5E)-5-(2-amino-3-fluoro-1-methoxypropyl)octa-3,5,7-trien-1-ol |
| SMILES | C=C/C=C(\C=C/CCO)C(OC)C(N)CF |
| InChI | InChI=1S/C12H20FNO2/c1-3-6-10(7-4-5-8-15)12(16-2)11(14)9-13/h3-4,6-7,11-12,15H,1,5,8-9,14H2,2H3/b7-4-,10-6+ |
| InChIKey | PUILRKODSPPLPH-HLWKLQMVSA-N |
| XLogP | 1.35 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|