C9H13NO — CID 142261507
2-amino-1-cyclohepta-1,4,6-trien-1-ylethanol (PubChem CID 142261507) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-amino-1-cyclohepta-1,4,6-trien-1-ylethanol.
| Compound Name | 2-amino-1-cyclohepta-1,4,6-trien-1-ylethanol |
|---|---|
| PubChem CID | 142261507 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 2-amino-1-cyclohepta-1,4,6-trien-1-ylethanol |
| SMILES | NCC(O)C1=CCC=CC=C1 |
| InChI | InChI=1S/C9H13NO/c10-7-9(11)8-5-3-1-2-4-6-8/h1-3,5-6,9,11H,4,7,10H2 |
| InChIKey | GDTVVBZNJKEFGY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |