C8H13NO — CID 143109865
(3E)-1-amino-3-ethenylhexa-3,5-dien-2-ol (PubChem CID 143109865) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (3E)-1-amino-3-ethenylhexa-3,5-dien-2-ol.
| Compound Name | (3E)-1-amino-3-ethenylhexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 143109865 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (3E)-1-amino-3-ethenylhexa-3,5-dien-2-ol |
| SMILES | C=C/C=C(\C=C)C(O)CN |
| InChI | InChI=1S/C8H13NO/c1-3-5-7(4-2)8(10)6-9/h3-5,8,10H,1-2,6,9H2/b7-5+ |
| InChIKey | PLARQGLTCWAOGY-FNORWQNLSA-N |
| XLogP | 0.60 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|