C10H13ClFN — CID 143095408
4-chloro-N-ethyl-2-fluoro-N,5-dimethylaniline (PubChem CID 143095408) has the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. Its IUPAC name is 4-chloro-N-ethyl-2-fluoro-N,5-dimethylaniline.
| Compound Name | 4-chloro-N-ethyl-2-fluoro-N,5-dimethylaniline |
|---|---|
| PubChem CID | 143095408 |
| Molecular Formula | C10H13ClFN |
| Molecular Weight | 201.67 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 4-chloro-N-ethyl-2-fluoro-N,5-dimethylaniline |
| SMILES | CCN(C)c1cc(C)c(Cl)cc1F |
| InChI | InChI=1S/C10H13ClFN/c1-4-13(3)10-5-7(2)8(11)6-9(10)12/h5-6H,4H2,1-3H3 |
| InChIKey | XDAHCNRKIYHXOX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.67 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |