C35H67N5O7S — CID 143106258
butane;N-[3-(cyclopropylamino)-2,3-dioxopropyl]-1-methylpyrrolidine-2-carboxamide;1-(3,3-dimethyl-1-oxobutan-2-yl)-3-(2-methyl-1-propan-2-ylsulfonyloctan-2-yl)urea (PubChem CID 143106258) has the molecular formula C35H67N5O7S and a molecular weight of 702.02 g/mol. Its IUPAC name is butane;N-[3-(cyclopropylamino)-2,3-dioxopropyl]-1-methylpyrrolidine-2-carboxamide;1-(3,3-dimethyl-1-oxobutan-2-yl)-3-(2-methyl-1-propan-2-ylsulfonyloctan-2-yl)urea.
| Compound Name | butane;N-[3-(cyclopropylamino)-2,3-dioxopropyl]-1-methylpyrrolidine-2-carboxamide;1-(3,3-dimethyl-1-oxobutan-2-yl)-3-(2-methyl-1-propan-2-ylsulfonyloctan-2-yl)urea |
|---|---|
| PubChem CID | 143106258 |
| Molecular Formula | C35H67N5O7S |
| Molecular Weight | 702.02 g/mol |
| Exact Mass | 701.48 |
| IUPAC Name | butane;N-[3-(cyclopropylamino)-2,3-dioxopropyl]-1-methylpyrrolidine-2-carboxamide;1-(3,3-dimethyl-1-oxobutan-2-yl)-3-(2-methyl-1-propan-2-ylsulfonyloctan-2-yl)urea |
| SMILES | CCCC.CCCCCCC(C)(CS(=O)(=O)C(C)C)NC(=O)NC(C=O)C(C)(C)C.CN1CCCC1C(=O)NCC(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C19H38N2O4S.C12H19N3O3.C4H10/c1-8-9-10-11-12-19(7,14-26(24,25)15(2)3)21-17(23)20-16(13-22)18(4,5)6;1-15-6-2-3-9(15)11(17)13-7-10(16)12(18)14-8-4-5-8;1-3-4-2/h13,15-16H,8-12,14H2,1-7H3,(H2,20,21,23);8-9H,2-7H2,1H3,(H,13,17)(H,14,18);3-4H2,1-2H3 |
| InChIKey | OJNYJYONHSLOLK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.02 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|