C14H19N3O4 — CID 143109073
4-[(N'-benzylcarbamimidoyl)amino]-6-hydroxy-5-oxohexanoic acid (PubChem CID 143109073) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-[(N'-benzylcarbamimidoyl)amino]-6-hydroxy-5-oxohexanoic acid.
| Compound Name | 4-[(N'-benzylcarbamimidoyl)amino]-6-hydroxy-5-oxohexanoic acid |
|---|---|
| PubChem CID | 143109073 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-[(N'-benzylcarbamimidoyl)amino]-6-hydroxy-5-oxohexanoic acid |
| SMILES | N/C(=N\Cc1ccccc1)NC(CCC(=O)O)C(=O)CO |
| InChI | InChI=1S/C14H19N3O4/c15-14(16-8-10-4-2-1-3-5-10)17-11(12(19)9-18)6-7-13(20)21/h1-5,11,18H,6-9H2,(H,20,21)(H3,15,16,17) |
| InChIKey | UVPFGJFXDQVZQA-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|