C11H22N2 — CID 143110117
N'-methyl-N'-[(Z)-3-[(Z)-prop-1-enyl]hex-3-enyl]methanediamine (PubChem CID 143110117) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is N'-methyl-N'-[(Z)-3-[(Z)-prop-1-enyl]hex-3-enyl]methanediamine.
| Compound Name | N'-methyl-N'-[(Z)-3-[(Z)-prop-1-enyl]hex-3-enyl]methanediamine |
|---|---|
| PubChem CID | 143110117 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N'-methyl-N'-[(Z)-3-[(Z)-prop-1-enyl]hex-3-enyl]methanediamine |
| SMILES | C/C=C\C(=C/CC)CCN(C)CN |
| InChI | InChI=1S/C11H22N2/c1-4-6-11(7-5-2)8-9-13(3)10-12/h4,6-7H,5,8-10,12H2,1-3H3/b6-4-,11-7+ |
| InChIKey | WKCOWGUVWASJEX-WXVRQDIQSA-N |
| XLogP | 2.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|