C18H27NO4 — CID 143111338
tert-butyl formate;(4-methylphenyl) 1-methylpyrrolidine-2-carboxylate (PubChem CID 143111338) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl formate;(4-methylphenyl) 1-methylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl formate;(4-methylphenyl) 1-methylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 143111338 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | tert-butyl formate;(4-methylphenyl) 1-methylpyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC=O.Cc1ccc(OC(=O)C2CCCN2C)cc1 |
| InChI | InChI=1S/C13H17NO2.C5H10O2/c1-10-5-7-11(8-6-10)16-13(15)12-4-3-9-14(12)2;1-5(2,3)7-4-6/h5-8,12H,3-4,9H2,1-2H3;4H,1-3H3 |
| InChIKey | YVMHNZQIEABHNH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|