C14H27NO3 — CID 144897436
(E)-1-[(2-methylpropan-2-yl)oxy]but-1-ene;1-methylpyrrolidine-2-carboxylic acid (PubChem CID 144897436) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is (E)-1-[(2-methylpropan-2-yl)oxy]but-1-ene;1-methylpyrrolidine-2-carboxylic acid.
| Compound Name | (E)-1-[(2-methylpropan-2-yl)oxy]but-1-ene;1-methylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 144897436 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | (E)-1-[(2-methylpropan-2-yl)oxy]but-1-ene;1-methylpyrrolidine-2-carboxylic acid |
| SMILES | CC/C=C/OC(C)(C)C.CN1CCCC1C(=O)O |
| InChI | InChI=1S/C8H16O.C6H11NO2/c1-5-6-7-9-8(2,3)4;1-7-4-2-3-5(7)6(8)9/h6-7H,5H2,1-4H3;5H,2-4H2,1H3,(H,8,9)/b7-6+; |
| InChIKey | BQMCGEDDCVSOGF-UHDJGPCESA-N |
| XLogP | 2.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|