C34H44ClN5O4 — CID 143111457
2-methoxyethyl 6-chloro-1-[4-[6-[3-imidazol-1-ylpropyl(methyl)amino]hexoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 143111457) has the molecular formula C34H44ClN5O4 and a molecular weight of 622.21 g/mol. Its IUPAC name is 2-methoxyethyl 6-chloro-1-[4-[6-[3-imidazol-1-ylpropyl(methyl)amino]hexoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | 2-methoxyethyl 6-chloro-1-[4-[6-[3-imidazol-1-ylpropyl(methyl)amino]hexoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 143111457 |
| Molecular Formula | C34H44ClN5O4 |
| Molecular Weight | 622.21 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | 2-methoxyethyl 6-chloro-1-[4-[6-[3-imidazol-1-ylpropyl(methyl)amino]hexoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COCCOC(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1ccc(OCCCCCCN(C)CCCn2ccnc2)cc1 |
| InChI | InChI=1S/C34H44ClN5O4/c1-38(17-7-18-39-20-15-36-25-39)16-5-3-4-6-21-43-28-11-8-26(9-12-28)33-32-29(30-24-27(35)10-13-31(30)37-32)14-19-40(33)34(41)44-23-22-42-2/h8-13,15,20,24-25,33,37H,3-7,14,16-19,21-23H2,1-2H3 |
| InChIKey | GUJCINAQYCBCEL-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.21 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|