C32H32Cl2N4O3 — CID 143111605
(2-chlorophenyl)methyl N-[(5-chloro-3-ethyl-1H-indol-2-yl)-[4-(3-imidazol-1-ylpropoxy)phenyl]methyl]-N-methylcarbamate (PubChem CID 143111605) has the molecular formula C32H32Cl2N4O3 and a molecular weight of 591.54 g/mol. Its IUPAC name is (2-chlorophenyl)methyl N-[(5-chloro-3-ethyl-1H-indol-2-yl)-[4-(3-imidazol-1-ylpropoxy)phenyl]methyl]-N-methylcarbamate.
| Compound Name | (2-chlorophenyl)methyl N-[(5-chloro-3-ethyl-1H-indol-2-yl)-[4-(3-imidazol-1-ylpropoxy)phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 143111605 |
| Molecular Formula | C32H32Cl2N4O3 |
| Molecular Weight | 591.54 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | (2-chlorophenyl)methyl N-[(5-chloro-3-ethyl-1H-indol-2-yl)-[4-(3-imidazol-1-ylpropoxy)phenyl]methyl]-N-methylcarbamate |
| SMILES | CCc1c(C(c2ccc(OCCCn3ccnc3)cc2)N(C)C(=O)OCc2ccccc2Cl)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C32H32Cl2N4O3/c1-3-26-27-19-24(33)11-14-29(27)36-30(26)31(37(2)32(39)41-20-23-7-4-5-8-28(23)34)22-9-12-25(13-10-22)40-18-6-16-38-17-15-35-21-38/h4-5,7-15,17,19,21,31,36H,3,6,16,18,20H2,1-2H3 |
| InChIKey | GJWSAYZCPCQTDU-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 72.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.54 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|