C23H31F3 — CID 143115205
2-(difluoromethyl)-3-fluoro-1-methyl-4-[4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexyl]benzene (PubChem CID 143115205) has the molecular formula C23H31F3 and a molecular weight of 364.50 g/mol. Its IUPAC name is 2-(difluoromethyl)-3-fluoro-1-methyl-4-[4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexyl]benzene.
| Compound Name | 2-(difluoromethyl)-3-fluoro-1-methyl-4-[4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 143115205 |
| Molecular Formula | C23H31F3 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 2-(difluoromethyl)-3-fluoro-1-methyl-4-[4-[(E)-2-(4-methylcyclohexyl)ethenyl]cyclohexyl]benzene |
| SMILES | Cc1ccc(C2CCC(/C=C/C3CCC(C)CC3)CC2)c(F)c1C(F)F |
| InChI | InChI=1S/C23H31F3/c1-15-3-6-17(7-4-15)8-9-18-10-12-19(13-11-18)20-14-5-16(2)21(22(20)24)23(25)26/h5,8-9,14-15,17-19,23H,3-4,6-7,10-13H2,1-2H3/b9-8+ |
| InChIKey | SKPAMZRXGSWJNY-CMDGGOBGSA-N |
| XLogP | 7.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|