C8H16N2 — CID 143115330
(4Z)-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen (PubChem CID 143115330) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (4Z)-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen.
| Compound Name | (4Z)-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 143115330 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (4Z)-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen |
| SMILES | C=C/C=C\C(CCN)=N\C.[H][H] |
| InChI | InChI=1S/C8H14N2.H2/c1-3-4-5-8(10-2)6-7-9;/h3-5H,1,6-7,9H2,2H3;1H/b5-4-,10-8-; |
| InChIKey | UWFTZTNNWJNDHL-BUVJRSHHSA-N |
| XLogP | 1.39 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|