C20H20N2 — CID 143119471
2,6-dimethyl-5-[(3Z)-penta-1,3-dien-2-yl]-1-phenylbenzimidazole (PubChem CID 143119471) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2,6-dimethyl-5-[(3Z)-penta-1,3-dien-2-yl]-1-phenylbenzimidazole.
| Compound Name | 2,6-dimethyl-5-[(3Z)-penta-1,3-dien-2-yl]-1-phenylbenzimidazole |
|---|---|
| PubChem CID | 143119471 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2,6-dimethyl-5-[(3Z)-penta-1,3-dien-2-yl]-1-phenylbenzimidazole |
| SMILES | C=C(/C=C\C)c1cc2nc(C)n(-c3ccccc3)c2cc1C |
| InChI | InChI=1S/C20H20N2/c1-5-9-14(2)18-13-19-20(12-15(18)3)22(16(4)21-19)17-10-7-6-8-11-17/h5-13H,2H2,1,3-4H3/b9-5- |
| InChIKey | ZWHDNGPLHGRVJK-UITAMQMPSA-N |
| XLogP | 5.23 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|