C33H26N4 — CID 154646982
11-[4-methyl-3-[(3Z)-penta-1,3-dien-2-yl]phenyl]-19-phenyl-2,9,11,19-tetrazapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),3,5,7,9,13,15,17-octaene (PubChem CID 154646982) has the molecular formula C33H26N4 and a molecular weight of 478.60 g/mol. Its IUPAC name is 11-[4-methyl-3-[(3Z)-penta-1,3-dien-2-yl]phenyl]-19-phenyl-2,9,11,19-tetrazapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),3,5,7,9,13,15,17-octaene.
| Compound Name | 11-[4-methyl-3-[(3Z)-penta-1,3-dien-2-yl]phenyl]-19-phenyl-2,9,11,19-tetrazapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),3,5,7,9,13,15,17-octaene |
|---|---|
| PubChem CID | 154646982 |
| Molecular Formula | C33H26N4 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 11-[4-methyl-3-[(3Z)-penta-1,3-dien-2-yl]phenyl]-19-phenyl-2,9,11,19-tetrazapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),3,5,7,9,13,15,17-octaene |
| SMILES | C=C(/C=C\C)c1cc(-n2c3c4ccccc4n(-c4ccccc4)c3n3c4ccccc4nc23)ccc1C |
| InChI | InChI=1S/C33H26N4/c1-4-12-22(2)27-21-25(20-19-23(27)3)36-31-26-15-8-10-17-29(26)35(24-13-6-5-7-14-24)32(31)37-30-18-11-9-16-28(30)34-33(36)37/h4-21H,2H2,1,3H3/b12-4- |
| InChIKey | DPONNPPWXJSCMB-QCDXTXTGSA-N |
| XLogP | 8.27 |
| TPSA | 27.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|