C26H29Cl2N5O2 — CID 143121894
2-[2-amino-4-(2,6-dichloro-3-hydroxyphenyl)-6-methylphenyl]-1-[4-(2-pyrrolidin-1-ylethoxy)phenyl]guanidine (PubChem CID 143121894) has the molecular formula C26H29Cl2N5O2 and a molecular weight of 514.46 g/mol. Its IUPAC name is 2-[2-amino-4-(2,6-dichloro-3-hydroxyphenyl)-6-methylphenyl]-1-[4-(2-pyrrolidin-1-ylethoxy)phenyl]guanidine.
| Compound Name | 2-[2-amino-4-(2,6-dichloro-3-hydroxyphenyl)-6-methylphenyl]-1-[4-(2-pyrrolidin-1-ylethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 143121894 |
| Molecular Formula | C26H29Cl2N5O2 |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 2-[2-amino-4-(2,6-dichloro-3-hydroxyphenyl)-6-methylphenyl]-1-[4-(2-pyrrolidin-1-ylethoxy)phenyl]guanidine |
| SMILES | Cc1cc(-c2c(Cl)ccc(O)c2Cl)cc(N)c1/N=C(\N)Nc1ccc(OCCN2CCCC2)cc1 |
| InChI | InChI=1S/C26H29Cl2N5O2/c1-16-14-17(23-20(27)8-9-22(34)24(23)28)15-21(29)25(16)32-26(30)31-18-4-6-19(7-5-18)35-13-12-33-10-2-3-11-33/h4-9,14-15,34H,2-3,10-13,29H2,1H3,(H3,30,31,32) |
| InChIKey | GCAVAQIKZRIJHJ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 109.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|