C25H29Cl2N7O — CID 143121939
1-[2-amino-4-(2,6-dichlorophenyl)-6-methylphenyl]-2-[2-methyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-yl]guanidine (PubChem CID 143121939) has the molecular formula C25H29Cl2N7O and a molecular weight of 514.46 g/mol. Its IUPAC name is 1-[2-amino-4-(2,6-dichlorophenyl)-6-methylphenyl]-2-[2-methyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-yl]guanidine.
| Compound Name | 1-[2-amino-4-(2,6-dichlorophenyl)-6-methylphenyl]-2-[2-methyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-yl]guanidine |
|---|---|
| PubChem CID | 143121939 |
| Molecular Formula | C25H29Cl2N7O |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 1-[2-amino-4-(2,6-dichlorophenyl)-6-methylphenyl]-2-[2-methyl-6-(2-pyrrolidin-1-ylethoxy)pyrimidin-4-yl]guanidine |
| SMILES | Cc1nc(/N=C(\N)Nc2c(C)cc(-c3c(Cl)cccc3Cl)cc2N)cc(OCCN2CCCC2)n1 |
| InChI | InChI=1S/C25H29Cl2N7O/c1-15-12-17(23-18(26)6-5-7-19(23)27)13-20(28)24(15)33-25(29)32-21-14-22(31-16(2)30-21)35-11-10-34-8-3-4-9-34/h5-7,12-14H,3-4,8-11,28H2,1-2H3,(H3,29,30,31,32,33) |
| InChIKey | CKYKSRHNXVIINZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|