C34H40N2O4 — CID 143123168
N-[(3S,4R)-4-[(1E,3E,5Z)-4-[3-[(2-methoxyphenyl)methoxy]propoxy]hepta-1,3,5-trienyl]piperidin-3-yl]naphthalene-1-carboxamide (PubChem CID 143123168) has the molecular formula C34H40N2O4 and a molecular weight of 540.70 g/mol. Its IUPAC name is N-[(3S,4R)-4-[(1E,3E,5Z)-4-[3-[(2-methoxyphenyl)methoxy]propoxy]hepta-1,3,5-trienyl]piperidin-3-yl]naphthalene-1-carboxamide.
| Compound Name | N-[(3S,4R)-4-[(1E,3E,5Z)-4-[3-[(2-methoxyphenyl)methoxy]propoxy]hepta-1,3,5-trienyl]piperidin-3-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 143123168 |
| Molecular Formula | C34H40N2O4 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | N-[(3S,4R)-4-[(1E,3E,5Z)-4-[3-[(2-methoxyphenyl)methoxy]propoxy]hepta-1,3,5-trienyl]piperidin-3-yl]naphthalene-1-carboxamide |
| SMILES | C/C=C\C(=C/C=C/[C@H]1CCNC[C@H]1NC(=O)c1cccc2ccccc12)OCCCOCc1ccccc1OC |
| InChI | InChI=1S/C34H40N2O4/c1-3-11-29(40-23-10-22-39-25-28-13-5-7-19-33(28)38-2)16-8-15-27-20-21-35-24-32(27)36-34(37)31-18-9-14-26-12-4-6-17-30(26)31/h3-9,11-19,27,32,35H,10,20-25H2,1-2H3,(H,36,37)/b11-3-,15-8+,29-16+/t27-,32+/m0/s1 |
| InChIKey | PJZHRMTVNOJSOT-SCAHAQPYSA-N |
| XLogP | 6.20 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|