C20H31N3O2 — CID 143125961
tert-butyl N-[(1S)-1-[4-(2,4-dimethyl-1,2,3,5-tetrahydro-1,4-diazepin-7-yl)phenyl]ethyl]carbamate (PubChem CID 143125961) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[4-(2,4-dimethyl-1,2,3,5-tetrahydro-1,4-diazepin-7-yl)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[4-(2,4-dimethyl-1,2,3,5-tetrahydro-1,4-diazepin-7-yl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 143125961 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | tert-butyl N-[(1S)-1-[4-(2,4-dimethyl-1,2,3,5-tetrahydro-1,4-diazepin-7-yl)phenyl]ethyl]carbamate |
| SMILES | CC1CN(C)CC=C(c2ccc([C@H](C)NC(=O)OC(C)(C)C)cc2)N1 |
| InChI | InChI=1S/C20H31N3O2/c1-14-13-23(6)12-11-18(21-14)17-9-7-16(8-10-17)15(2)22-19(24)25-20(3,4)5/h7-11,14-15,21H,12-13H2,1-6H3,(H,22,24)/t14?,15-/m0/s1 |
| InChIKey | SBHVSJLOQSRBOS-LOACHALJSA-N |
| XLogP | 3.54 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |