C24H26FN3O5 — CID 143126544
methyl 8-[2-[4-[(2E)-2-ethenylpenta-2,4-dienoyl]piperazin-1-yl]-2-oxoacetyl]-6-fluoro-7-methyl-1H-azonine-3-carboxylate (PubChem CID 143126544) has the molecular formula C24H26FN3O5 and a molecular weight of 455.49 g/mol. Its IUPAC name is methyl 8-[2-[4-[(2E)-2-ethenylpenta-2,4-dienoyl]piperazin-1-yl]-2-oxoacetyl]-6-fluoro-7-methyl-1H-azonine-3-carboxylate.
| Compound Name | methyl 8-[2-[4-[(2E)-2-ethenylpenta-2,4-dienoyl]piperazin-1-yl]-2-oxoacetyl]-6-fluoro-7-methyl-1H-azonine-3-carboxylate |
|---|---|
| PubChem CID | 143126544 |
| Molecular Formula | C24H26FN3O5 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | methyl 8-[2-[4-[(2E)-2-ethenylpenta-2,4-dienoyl]piperazin-1-yl]-2-oxoacetyl]-6-fluoro-7-methyl-1H-azonine-3-carboxylate |
| SMILES | C=C/C=C(\C=C)C(=O)N1CCN(C(=O)C(=O)c2c[nH]cc(C(=O)OC)ccc(F)c2C)CC1 |
| InChI | InChI=1S/C24H26FN3O5/c1-5-7-17(6-2)22(30)27-10-12-28(13-11-27)23(31)21(29)19-15-26-14-18(24(32)33-4)8-9-20(25)16(19)3/h5-9,14-15,26H,1-2,10-13H2,3-4H3/b9-8-,17-7+,18-14+,19-15+,20-16+ |
| InChIKey | RISNPHUTTUHSHR-FFWFSYCTSA-N |
| XLogP | 2.53 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|