C23H27N3O3 — CID 142032724
1-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-[4-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]piperazin-1-yl]ethane-1,2-dione (PubChem CID 142032724) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-[4-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-[4-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 142032724 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 1-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-[4-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]piperazin-1-yl]ethane-1,2-dione |
| SMILES | C=C/C=c1/c(C(=O)C(=O)N2CCN(C(=O)C(/C=C\C)=C/C=C)CC2)c[nH]/c1=C/C |
| InChI | InChI=1S/C23H27N3O3/c1-5-9-17(10-6-2)22(28)25-12-14-26(15-13-25)23(29)21(27)19-16-24-20(8-4)18(19)11-7-3/h5-11,16,24H,1,3,12-15H2,2,4H3/b10-6-,17-9+,18-11-,20-8+ |
| InChIKey | BGYDXKRRLBYDGV-ZQUFHJRUSA-N |
| XLogP | 1.32 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|