C23H22O7 — CID 143128422
2-[4-(2-methoxy-2-oxoethyl)-2-oxochromen-7-yl]oxy-5-phenylpentanoic acid (PubChem CID 143128422) has the molecular formula C23H22O7 and a molecular weight of 410.42 g/mol. Its IUPAC name is 2-[4-(2-methoxy-2-oxoethyl)-2-oxochromen-7-yl]oxy-5-phenylpentanoic acid.
| Compound Name | 2-[4-(2-methoxy-2-oxoethyl)-2-oxochromen-7-yl]oxy-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 143128422 |
| Molecular Formula | C23H22O7 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-[4-(2-methoxy-2-oxoethyl)-2-oxochromen-7-yl]oxy-5-phenylpentanoic acid |
| SMILES | COC(=O)Cc1cc(=O)oc2cc(OC(CCCc3ccccc3)C(=O)O)ccc12 |
| InChI | InChI=1S/C23H22O7/c1-28-21(24)12-16-13-22(25)30-20-14-17(10-11-18(16)20)29-19(23(26)27)9-5-8-15-6-3-2-4-7-15/h2-4,6-7,10-11,13-14,19H,5,8-9,12H2,1H3,(H,26,27) |
| InChIKey | PLVWOWGICOZDMN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|