C10H10N2 — CID 143128859
2-cyclohexa-2,5-dien-1-ylidene-3-methyliminopropanenitrile (PubChem CID 143128859) has the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-cyclohexa-2,5-dien-1-ylidene-3-methyliminopropanenitrile.
| Compound Name | 2-cyclohexa-2,5-dien-1-ylidene-3-methyliminopropanenitrile |
|---|---|
| PubChem CID | 143128859 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 2-cyclohexa-2,5-dien-1-ylidene-3-methyliminopropanenitrile |
| SMILES | C/N=C/C(C#N)=C1C=CCC=C1 |
| InChI | InChI=1S/C10H10N2/c1-12-8-10(7-11)9-5-3-2-4-6-9/h3-6,8H,2H2,1H3/b12-8+ |
| InChIKey | NHMDRXBZQDYFOS-XYOKQWHBSA-N |
| XLogP | 2.02 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|