C27H43N3O3S — CID 143130174
N-(2,3-dimethylcyclohexyl)-11-methyl-9-oxo-10-(3-propylsulfanylpropyl)-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide;ethane (PubChem CID 143130174) has the molecular formula C27H43N3O3S and a molecular weight of 489.73 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-11-methyl-9-oxo-10-(3-propylsulfanylpropyl)-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide;ethane.
| Compound Name | N-(2,3-dimethylcyclohexyl)-11-methyl-9-oxo-10-(3-propylsulfanylpropyl)-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide;ethane |
|---|---|
| PubChem CID | 143130174 |
| Molecular Formula | C27H43N3O3S |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-11-methyl-9-oxo-10-(3-propylsulfanylpropyl)-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide;ethane |
| SMILES | CC.CCCSCCCN1C(=O)c2cc3occc3n2CC1(C)C(=O)NC1CCCC(C)C1C |
| InChI | InChI=1S/C25H37N3O3S.C2H6/c1-5-13-32-14-7-11-28-23(29)21-15-22-20(10-12-31-22)27(21)16-25(28,4)24(30)26-19-9-6-8-17(2)18(19)3;1-2/h10,12,15,17-19H,5-9,11,13-14,16H2,1-4H3,(H,26,30);1-2H3 |
| InChIKey | KIURWXIDOZNBQP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|