C20H23NO2 — CID 143136838
N-ethyl-3-hydroxynaphthalene-2-carboxamide;(3Z,5Z)-hepta-1,3,5-triene (PubChem CID 143136838) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-ethyl-3-hydroxynaphthalene-2-carboxamide;(3Z,5Z)-hepta-1,3,5-triene.
| Compound Name | N-ethyl-3-hydroxynaphthalene-2-carboxamide;(3Z,5Z)-hepta-1,3,5-triene |
|---|---|
| PubChem CID | 143136838 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-ethyl-3-hydroxynaphthalene-2-carboxamide;(3Z,5Z)-hepta-1,3,5-triene |
| SMILES | C=C/C=C\C=C/C.CCNC(=O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C13H13NO2.C7H10/c1-2-14-13(16)11-7-9-5-3-4-6-10(9)8-12(11)15;1-3-5-7-6-4-2/h3-8,15H,2H2,1H3,(H,14,16);3-7H,1H2,2H3/b;6-4-,7-5- |
| InChIKey | XDZFEXKRLDRZIK-WRFMUYTLSA-N |
| XLogP | 4.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|