C12H23NO — CID 143137226
ethane;(3Z)-penta-1,3-diene;N-[(E)-prop-1-enyl]acetamide (PubChem CID 143137226) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is ethane;(3Z)-penta-1,3-diene;N-[(E)-prop-1-enyl]acetamide.
| Compound Name | ethane;(3Z)-penta-1,3-diene;N-[(E)-prop-1-enyl]acetamide |
|---|---|
| PubChem CID | 143137226 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | ethane;(3Z)-penta-1,3-diene;N-[(E)-prop-1-enyl]acetamide |
| SMILES | C/C=C/NC(C)=O.C=C/C=C\C.CC |
| InChI | InChI=1S/C5H9NO.C5H8.C2H6/c1-3-4-6-5(2)7;1-3-5-4-2;1-2/h3-4H,1-2H3,(H,6,7);3-5H,1H2,2H3;1-2H3/b4-3+;5-4-; |
| InChIKey | NZXMDEWRDKJMMB-CHBDRQJASA-N |
| XLogP | 3.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|