C24H28N2O7S — CID 143139200
ethane;ethyl 2-methyl-4-(3-oxopropyl)-5-[(Z)-(4,4,8-trioxo-2,7-dihydro-1H-oxathiino[4,3-e]indol-9-ylidene)methyl]-1H-pyrrole-3-carboxylate (PubChem CID 143139200) has the molecular formula C24H28N2O7S and a molecular weight of 488.56 g/mol. Its IUPAC name is ethane;ethyl 2-methyl-4-(3-oxopropyl)-5-[(Z)-(4,4,8-trioxo-2,7-dihydro-1H-oxathiino[4,3-e]indol-9-ylidene)methyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethane;ethyl 2-methyl-4-(3-oxopropyl)-5-[(Z)-(4,4,8-trioxo-2,7-dihydro-1H-oxathiino[4,3-e]indol-9-ylidene)methyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 143139200 |
| Molecular Formula | C24H28N2O7S |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | ethane;ethyl 2-methyl-4-(3-oxopropyl)-5-[(Z)-(4,4,8-trioxo-2,7-dihydro-1H-oxathiino[4,3-e]indol-9-ylidene)methyl]-1H-pyrrole-3-carboxylate |
| SMILES | CC.CCOC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc4c(c32)CCOS4(=O)=O)c1CCC=O |
| InChI | InChI=1S/C22H22N2O7S.C2H6/c1-3-30-22(27)19-12(2)23-17(13(19)5-4-9-25)11-15-20-14-8-10-31-32(28,29)18(14)7-6-16(20)24-21(15)26;1-2/h6-7,9,11,23H,3-5,8,10H2,1-2H3,(H,24,26);1-2H3/b15-11-; |
| InChIKey | CMMZHMALAUFWHP-PNCOJPCNSA-N |
| XLogP | 3.41 |
| TPSA | 131.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|