C24H28N4O5S — CID 11547574
4-methyl-N-(3-pyrrolidin-1-ylpropyl)-5-[(Z)-(4,4,8-trioxo-2,7-dihydro-1H-oxathiino[4,3-e]indol-9-ylidene)methyl]-1H-pyrrole-2-carboxamide (PubChem CID 11547574) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is 4-methyl-N-(3-pyrrolidin-1-ylpropyl)-5-[(Z)-(4,4,8-trioxo-2,7-dihydro-1H-oxathiino[4,3-e]indol-9-ylidene)methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-methyl-N-(3-pyrrolidin-1-ylpropyl)-5-[(Z)-(4,4,8-trioxo-2,7-dihydro-1H-oxathiino[4,3-e]indol-9-ylidene)methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 11547574 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 4-methyl-N-(3-pyrrolidin-1-ylpropyl)-5-[(Z)-(4,4,8-trioxo-2,7-dihydro-1H-oxathiino[4,3-e]indol-9-ylidene)methyl]-1H-pyrrole-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCN2CCCC2)[nH]c1/C=C1\C(=O)Nc2ccc3c(c21)CCOS3(=O)=O |
| InChI | InChI=1S/C24H28N4O5S/c1-15-13-20(24(30)25-8-4-11-28-9-2-3-10-28)26-19(15)14-17-22-16-7-12-33-34(31,32)21(16)6-5-18(22)27-23(17)29/h5-6,13-14,26H,2-4,7-12H2,1H3,(H,25,30)(H,27,29)/b17-14- |
| InChIKey | CBBCNMBBNZETNC-VKAVYKQESA-N |
| XLogP | 2.29 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|