C18H16N2O6S — CID 11646754
2,4-dimethyl-5-[(Z)-(4,4,8-trioxo-2,7-dihydro-1H-oxathiino[4,3-e]indol-9-ylidene)methyl]-1H-pyrrole-3-carboxylic acid (PubChem CID 11646754) has the molecular formula C18H16N2O6S and a molecular weight of 388.40 g/mol. Its IUPAC name is 2,4-dimethyl-5-[(Z)-(4,4,8-trioxo-2,7-dihydro-1H-oxathiino[4,3-e]indol-9-ylidene)methyl]-1H-pyrrole-3-carboxylic acid.
| Compound Name | 2,4-dimethyl-5-[(Z)-(4,4,8-trioxo-2,7-dihydro-1H-oxathiino[4,3-e]indol-9-ylidene)methyl]-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 11646754 |
| Molecular Formula | C18H16N2O6S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 2,4-dimethyl-5-[(Z)-(4,4,8-trioxo-2,7-dihydro-1H-oxathiino[4,3-e]indol-9-ylidene)methyl]-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc4c(c32)CCOS4(=O)=O)c(C)c1C(=O)O |
| InChI | InChI=1S/C18H16N2O6S/c1-8-13(19-9(2)15(8)18(22)23)7-11-16-10-5-6-26-27(24,25)14(10)4-3-12(16)20-17(11)21/h3-4,7,19H,5-6H2,1-2H3,(H,20,21)(H,22,23)/b11-7- |
| InChIKey | DITAONANJOIOCS-XFFZJAGNSA-N |
| XLogP | 2.08 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|