C8H9NS — CID 143139884
(3aS)-2-methyl-3a,7a-dihydro-1,3-benzothiazole (PubChem CID 143139884) has the molecular formula C8H9NS and a molecular weight of 151.23 g/mol. Its IUPAC name is (3aS)-2-methyl-3a,7a-dihydro-1,3-benzothiazole.
| Compound Name | (3aS)-2-methyl-3a,7a-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 143139884 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | (3aS)-2-methyl-3a,7a-dihydro-1,3-benzothiazole |
| SMILES | CC1=N[C@H]2C=CC=CC2S1 |
| InChI | InChI=1S/C8H9NS/c1-6-9-7-4-2-3-5-8(7)10-6/h2-5,7-8H,1H3/t7-,8?/m0/s1 |
| InChIKey | DPVKVNPMTXXHLV-JAMMHHFISA-N |
| XLogP | 2.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |