C8H16N2S — CID 143142425
N,4-dimethyl-5-propyl-1,3-thiazolidin-2-imine (PubChem CID 143142425) has the molecular formula C8H16N2S and a molecular weight of 172.30 g/mol. Its IUPAC name is N,4-dimethyl-5-propyl-1,3-thiazolidin-2-imine.
| Compound Name | N,4-dimethyl-5-propyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 143142425 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | N,4-dimethyl-5-propyl-1,3-thiazolidin-2-imine |
| SMILES | CCCC1S/C(=N\C)NC1C |
| InChI | InChI=1S/C8H16N2S/c1-4-5-7-6(2)10-8(9-3)11-7/h6-7H,4-5H2,1-3H3,(H,9,10) |
| InChIKey | WZHWXVCOVHSWSK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|