C21H30S — CID 143143936
ethane;13-ethyl-5,5,13-trimethyl-9-thiatricyclo[8.5.0.02,8]pentadeca-1(15),2(8),3,6,10-pentaene (PubChem CID 143143936) has the molecular formula C21H30S and a molecular weight of 314.54 g/mol. Its IUPAC name is ethane;13-ethyl-5,5,13-trimethyl-9-thiatricyclo[8.5.0.02,8]pentadeca-1(15),2(8),3,6,10-pentaene.
| Compound Name | ethane;13-ethyl-5,5,13-trimethyl-9-thiatricyclo[8.5.0.02,8]pentadeca-1(15),2(8),3,6,10-pentaene |
|---|---|
| PubChem CID | 143143936 |
| Molecular Formula | C21H30S |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | ethane;13-ethyl-5,5,13-trimethyl-9-thiatricyclo[8.5.0.02,8]pentadeca-1(15),2(8),3,6,10-pentaene |
| SMILES | CC.CCC1(C)CC=c2sc3c(c2=CC1)C=CC(C)(C)C=C3 |
| InChI | InChI=1S/C19H24S.C2H6/c1-5-19(4)12-7-15-14-6-10-18(2,3)11-8-16(14)20-17(15)9-13-19;1-2/h6-11H,5,12-13H2,1-4H3;1-2H3 |
| InChIKey | GQVDNIXEKXDUNH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |