C19H28S — CID 143322112
6-tert-butyl-2-(3-methylpentan-3-yl)-5H-cyclohepta[b]thiophene (PubChem CID 143322112) has the molecular formula C19H28S and a molecular weight of 288.50 g/mol. Its IUPAC name is 6-tert-butyl-2-(3-methylpentan-3-yl)-5H-cyclohepta[b]thiophene.
| Compound Name | 6-tert-butyl-2-(3-methylpentan-3-yl)-5H-cyclohepta[b]thiophene |
|---|---|
| PubChem CID | 143322112 |
| Molecular Formula | C19H28S |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 6-tert-butyl-2-(3-methylpentan-3-yl)-5H-cyclohepta[b]thiophene |
| SMILES | CCC(C)(CC)c1cc2c(s1)=CC=C(C(C)(C)C)CC=2 |
| InChI | InChI=1S/C19H28S/c1-7-19(6,8-2)17-13-14-9-10-15(18(3,4)5)11-12-16(14)20-17/h9,11-13H,7-8,10H2,1-6H3 |
| InChIKey | SFMCMUYMDVCUPV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |