C20H32S — CID 142075098
2-[(2E,6E)-3,7-dimethyldeca-2,6-dienyl]-2,3,4-trimethyl-5-methylidenethiophene (PubChem CID 142075098) has the molecular formula C20H32S and a molecular weight of 304.54 g/mol. Its IUPAC name is 2-[(2E,6E)-3,7-dimethyldeca-2,6-dienyl]-2,3,4-trimethyl-5-methylidenethiophene.
| Compound Name | 2-[(2E,6E)-3,7-dimethyldeca-2,6-dienyl]-2,3,4-trimethyl-5-methylidenethiophene |
|---|---|
| PubChem CID | 142075098 |
| Molecular Formula | C20H32S |
| Molecular Weight | 304.54 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-[(2E,6E)-3,7-dimethyldeca-2,6-dienyl]-2,3,4-trimethyl-5-methylidenethiophene |
| SMILES | C=C1SC(C)(C/C=C(\C)CC/C=C(\C)CCC)C(C)=C1C |
| InChI | InChI=1S/C20H32S/c1-8-10-15(2)11-9-12-16(3)13-14-20(7)18(5)17(4)19(6)21-20/h11,13H,6,8-10,12,14H2,1-5,7H3/b15-11+,16-13+ |
| InChIKey | YEPXSIBHPTXSFV-NWFDBUFXSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.54 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|